C10H16O — CID 14262022
6a-methyl-4-methylidene-1,2,3,3a,5,6-hexahydropentalen-1-ol (PubChem CID 14262022) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 6a-methyl-4-methylidene-1,2,3,3a,5,6-hexahydropentalen-1-ol.
| Compound Name | 6a-methyl-4-methylidene-1,2,3,3a,5,6-hexahydropentalen-1-ol |
|---|---|
| PubChem CID | 14262022 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 6a-methyl-4-methylidene-1,2,3,3a,5,6-hexahydropentalen-1-ol |
| SMILES | C=C1CCC2(C)C(O)CCC12 |
| InChI | InChI=1S/C10H16O/c1-7-5-6-10(2)8(7)3-4-9(10)11/h8-9,11H,1,3-6H2,2H3 |
| InChIKey | NKDBVVVSKBOOBJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|