C21H30F6O2Si — CID 18426894
7a-methyl-1-[(E)-7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-one (PubChem CID 18426894) has the molecular formula C21H30F6O2Si and a molecular weight of 456.54 g/mol. Its IUPAC name is 7a-methyl-1-[(E)-7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-one.
| Compound Name | 7a-methyl-1-[(E)-7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-one |
|---|---|
| PubChem CID | 18426894 |
| Molecular Formula | C21H30F6O2Si |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 7a-methyl-1-[(E)-7,7,7-trifluoro-6-(trifluoromethyl)-6-trimethylsilyloxyhept-4-en-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-one |
| SMILES | CC(C/C=C/C(O[Si](C)(C)C)(C(F)(F)F)C(F)(F)F)C1=CCC2C(=O)CCCC12C |
| InChI | InChI=1S/C21H30F6O2Si/c1-14(15-10-11-16-17(28)9-7-12-18(15,16)2)8-6-13-19(20(22,23)24,21(25,26)27)29-30(3,4)5/h6,10,13-14,16H,7-9,11-12H2,1-5H3/b13-6+ |
| InChIKey | KGBAEGVLPXEBGJ-AWNIVKPZSA-N |
| XLogP | 6.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|