C20H31O2Si — CID 59964404
CID 59964404 (PubChem CID 59964404) has the molecular formula C20H31O2Si and a molecular weight of 331.55 g/mol.
| Compound Name | CID 59964404 |
|---|---|
| PubChem CID | 59964404 |
| Molecular Formula | C20H31O2Si |
| Molecular Weight | 331.55 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | — |
| SMILES | C[C@H](CC#CC(C)(C)O[Si](C)C)C1=CCC2C(=O)CCC[C@]12C |
| InChI | InChI=1S/C20H31O2Si/c1-15(9-7-13-19(2,3)22-23(5)6)16-11-12-17-18(21)10-8-14-20(16,17)4/h11,15,17H,8-10,12,14H2,1-6H3/t15-,17?,20-/m1/s1 |
| InChIKey | CJDLXBSWQLMBMV-QMBUQHDCSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|