C31H42O4 — CID 54345364
[(1R)-3-[2-[(3aS,7aS)-1-[(2R)-6-acetyloxy-6-methylhept-4-yn-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate (PubChem CID 54345364) has the molecular formula C31H42O4 and a molecular weight of 478.67 g/mol. Its IUPAC name is [(1R)-3-[2-[(3aS,7aS)-1-[(2R)-6-acetyloxy-6-methylhept-4-yn-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate.
| Compound Name | [(1R)-3-[2-[(3aS,7aS)-1-[(2R)-6-acetyloxy-6-methylhept-4-yn-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate |
|---|---|
| PubChem CID | 54345364 |
| Molecular Formula | C31H42O4 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.31 |
| IUPAC Name | [(1R)-3-[2-[(3aS,7aS)-1-[(2R)-6-acetyloxy-6-methylhept-4-yn-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexyl] acetate |
| SMILES | C=C1CC[C@@H](OC(C)=O)CC1=CC=C1CCC[C@]2(C)C([C@H](C)CC#CC(C)(C)OC(C)=O)=CC[C@@H]12 |
| InChI | InChI=1S/C31H42O4/c1-21-12-15-27(34-23(3)32)20-26(21)14-13-25-11-9-19-31(7)28(16-17-29(25)31)22(2)10-8-18-30(5,6)35-24(4)33/h13-14,16,22,27,29H,1,9-12,15,17,19-20H2,2-7H3/t22-,27-,29+,31-/m1/s1 |
| InChIKey | UBYIMVVFPJEXEC-DWZHTTJUSA-N |
| XLogP | 7.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|