C30H44 — CID 142099808
(7E)-3-(6,6-dimethylhept-4-yn-2-yl)-7-[(2Z)-2-(3,5-dimethyl-2-methylidenecyclohexylidene)ethylidene]-3a-methyl-4,5,6,7a-tetrahydro-1H-indene (PubChem CID 142099808) has the molecular formula C30H44 and a molecular weight of 404.68 g/mol. Its IUPAC name is (7E)-3-(6,6-dimethylhept-4-yn-2-yl)-7-[(2Z)-2-(3,5-dimethyl-2-methylidenecyclohexylidene)ethylidene]-3a-methyl-4,5,6,7a-tetrahydro-1H-indene.
| Compound Name | (7E)-3-(6,6-dimethylhept-4-yn-2-yl)-7-[(2Z)-2-(3,5-dimethyl-2-methylidenecyclohexylidene)ethylidene]-3a-methyl-4,5,6,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 142099808 |
| Molecular Formula | C30H44 |
| Molecular Weight | 404.68 g/mol |
| Exact Mass | 404.34 |
| IUPAC Name | (7E)-3-(6,6-dimethylhept-4-yn-2-yl)-7-[(2Z)-2-(3,5-dimethyl-2-methylidenecyclohexylidene)ethylidene]-3a-methyl-4,5,6,7a-tetrahydro-1H-indene |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)C(C(C)CC#CC(C)(C)C)=CCC23)CC(C)CC1C |
| InChI | InChI=1S/C30H44/c1-21-19-23(3)24(4)26(20-21)14-13-25-12-10-18-30(8)27(15-16-28(25)30)22(2)11-9-17-29(5,6)7/h13-15,21-23,28H,4,10-12,16,18-20H2,1-3,5-8H3/b25-13+,26-14- |
| InChIKey | HPIAHSOIKFFFCW-STRMTGLTSA-N |
| XLogP | 8.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.68 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|