C30H36F6O5 — CID 143025641
[(5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate (PubChem CID 143025641) has the molecular formula C30H36F6O5 and a molecular weight of 590.60 g/mol. Its IUPAC name is [(5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate.
| Compound Name | [(5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate |
|---|---|
| PubChem CID | 143025641 |
| Molecular Formula | C30H36F6O5 |
| Molecular Weight | 590.60 g/mol |
| Exact Mass | 590.25 |
| IUPAC Name | [(5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(2R)-7,7,7-trifluoro-6-hydroxy-6-(trifluoromethyl)hept-4-yn-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate |
| SMILES | CC(=O)OC1C/C(=C\C=C2/CCC[C@]3(C)C([C@H](C)CC#CC(O)(C(F)(F)F)C(F)(F)F)=CCC23)C[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C30H36F6O5/c1-18(7-5-14-28(39,29(31,32)33)30(34,35)36)25-11-12-26-22(8-6-13-27(25,26)4)10-9-21-15-23(40-19(2)37)17-24(16-21)41-20(3)38/h9-11,18,23-24,26,39H,6-8,12-13,15-17H2,1-4H3/b21-9-,22-10+/t18-,23-,24?,26?,27-/m1/s1 |
| InChIKey | LOKKHZVPLKDZIT-BKCVYNMWSA-N |
| XLogP | 6.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|