C44H82O5Si3 — CID 90756740
[(1S)-1-[(3aS,7aS)-4-[2-[(3R,5R)-3,5-bis(triethylsilyloxy)cyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl] 4-methyl-4-triethylsilyloxypentanoate (PubChem CID 90756740) has the molecular formula C44H82O5Si3 and a molecular weight of 775.39 g/mol. Its IUPAC name is [(1S)-1-[(3aS,7aS)-4-[2-[(3R,5R)-3,5-bis(triethylsilyloxy)cyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl] 4-methyl-4-triethylsilyloxypentanoate.
| Compound Name | [(1S)-1-[(3aS,7aS)-4-[2-[(3R,5R)-3,5-bis(triethylsilyloxy)cyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl] 4-methyl-4-triethylsilyloxypentanoate |
|---|---|
| PubChem CID | 90756740 |
| Molecular Formula | C44H82O5Si3 |
| Molecular Weight | 775.39 g/mol |
| Exact Mass | 774.55 |
| IUPAC Name | [(1S)-1-[(3aS,7aS)-4-[2-[(3R,5R)-3,5-bis(triethylsilyloxy)cyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethyl] 4-methyl-4-triethylsilyloxypentanoate |
| SMILES | CC[Si](CC)(CC)O[C@@H]1CC(=CC=C2CCC[C@]3(C)C([C@H](C)OC(=O)CCC(C)(C)O[Si](CC)(CC)CC)=CC[C@@H]23)C[C@@H](O[Si](CC)(CC)CC)C1 |
| InChI | InChI=1S/C44H82O5Si3/c1-14-50(15-2,16-3)47-38-32-36(33-39(34-38)48-51(17-4,18-5)19-6)25-26-37-24-23-30-44(13)40(27-28-41(37)44)35(10)46-42(45)29-31-43(11,12)49-52(20-7,21-8)22-9/h25-27,35,38-39,41H,14-24,28-34H2,1-13H3/t35-,38+,39+,41-,44+/m0/s1 |
| InChIKey | BKHBGHXVXJVNPJ-PDGMBTCWSA-N |
| XLogP | 13.45 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.39 |
| LogP ≤ 5 | 13.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|