C35H61NO4Si2 — CID 87347321
2-[(1S)-1-[(7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetamide (PubChem CID 87347321) has the molecular formula C35H61NO4Si2 and a molecular weight of 616.05 g/mol. Its IUPAC name is 2-[(1S)-1-[(7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetamide.
| Compound Name | 2-[(1S)-1-[(7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetamide |
|---|---|
| PubChem CID | 87347321 |
| Molecular Formula | C35H61NO4Si2 |
| Molecular Weight | 616.05 g/mol |
| Exact Mass | 615.41 |
| IUPAC Name | 2-[(1S)-1-[(7aS)-4-[2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetamide |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C([C@H](C)OCC(N)=O)=CCC23)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H61NO4Si2/c1-24-27(17-16-26-15-14-20-35(9)29(18-19-30(26)35)25(2)38-23-32(36)37)21-28(39-41(10,11)33(3,4)5)22-31(24)40-42(12,13)34(6,7)8/h16-18,25,28,30-31H,1,14-15,19-23H2,2-13H3,(H2,36,37)/t25-,28+,30?,31-,35+/m0/s1 |
| InChIKey | WOUICZQCUHTDIW-LKTAOHTESA-N |
| XLogP | 9.00 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.05 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|