C27H40O3S — CID 87347023
1-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-3,3-dimethylbutane-2-thione (PubChem CID 87347023) has the molecular formula C27H40O3S and a molecular weight of 444.68 g/mol. Its IUPAC name is 1-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-3,3-dimethylbutane-2-thione.
| Compound Name | 1-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-3,3-dimethylbutane-2-thione |
|---|---|
| PubChem CID | 87347023 |
| Molecular Formula | C27H40O3S |
| Molecular Weight | 444.68 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 1-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-3,3-dimethylbutane-2-thione |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C([C@H](C)OCC(=S)C(C)(C)C)=CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H40O3S/c1-17-20(14-21(28)15-24(17)29)10-9-19-8-7-13-27(6)22(11-12-23(19)27)18(2)30-16-25(31)26(3,4)5/h9-11,18,21,23-24,28-29H,1,7-8,12-16H2,2-6H3/t18-,21+,23-,24-,27+/m0/s1 |
| InChIKey | JEEPGNDJUGJOLO-RQUFJMQXSA-N |
| XLogP | 5.87 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.68 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|