C30H46O5 — CID 87346970
2,3,3-trimethylbutan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate (PubChem CID 87346970) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is 2,3,3-trimethylbutan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate.
| Compound Name | 2,3,3-trimethylbutan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 87346970 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 2,3,3-trimethylbutan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C([C@H](C)OCC(=O)OC(C)(C)C(C)(C)C)=CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C30H46O5/c1-19-22(16-23(31)17-26(19)32)12-11-21-10-9-15-30(8)24(13-14-25(21)30)20(2)34-18-27(33)35-29(6,7)28(3,4)5/h11-13,20,23,25-26,31-32H,1,9-10,14-18H2,2-8H3/t20-,23+,25-,26-,30+/m0/s1 |
| InChIKey | JOIXYXKTVLLATN-PIDPECNFSA-N |
| XLogP | 5.82 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|