C27H38O5 — CID 87347101
methyl (2S)-2-[1-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-2-cyclopropylacetate (PubChem CID 87347101) has the molecular formula C27H38O5 and a molecular weight of 442.60 g/mol. Its IUPAC name is methyl (2S)-2-[1-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-2-cyclopropylacetate.
| Compound Name | methyl (2S)-2-[1-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-2-cyclopropylacetate |
|---|---|
| PubChem CID | 87347101 |
| Molecular Formula | C27H38O5 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | methyl (2S)-2-[1-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]-2-cyclopropylacetate |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C(C(C)O[C@H](C(=O)OC)C4CC4)=CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C27H38O5/c1-16-20(14-21(28)15-24(16)29)10-7-18-6-5-13-27(3)22(11-12-23(18)27)17(2)32-25(19-8-9-19)26(30)31-4/h7,10-11,17,19,21,23-25,28-29H,1,5-6,8-9,12-15H2,2-4H3/b18-7+,20-10-/t17?,21-,23+,24+,25+,27-/m1/s1 |
| InChIKey | NKKWTQTUZDVEJA-PCPFQFFBSA-N |
| XLogP | 4.40 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|