C29H44O4 — CID 71680420
tert-butyl (5R)-5-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5S)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hexanoate (PubChem CID 71680420) has the molecular formula C29H44O4 and a molecular weight of 456.67 g/mol. Its IUPAC name is tert-butyl (5R)-5-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5S)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hexanoate.
| Compound Name | tert-butyl (5R)-5-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5S)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hexanoate |
|---|---|
| PubChem CID | 71680420 |
| Molecular Formula | C29H44O4 |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.32 |
| IUPAC Name | tert-butyl (5R)-5-[(3aS,4E,7aS)-4-[(2Z)-2-[(3S,5S)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hexanoate |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C([C@H](C)CCCC(=O)OC(C)(C)C)=CC[C@@H]23)C[C@H](O)C[C@@H]1O |
| InChI | InChI=1S/C29H44O4/c1-19(9-7-11-27(32)33-28(3,4)5)24-14-15-25-21(10-8-16-29(24,25)6)12-13-22-17-23(30)18-26(31)20(22)2/h12-14,19,23,25-26,30-31H,2,7-11,15-18H2,1,3-6H3/b21-12+,22-13-/t19-,23+,25+,26+,29-/m1/s1 |
| InChIKey | IOFZSLNSSKABNF-QSIOEVBISA-N |
| XLogP | 6.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|