C30H47NO2 — CID 58581983
trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(2R)-7,7-dimethyl-6-methyliminooctan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 58581983) has the molecular formula C30H47NO2 and a molecular weight of 453.71 g/mol. Its IUPAC name is trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(2R)-7,7-dimethyl-6-methyliminooctan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(2R)-7,7-dimethyl-6-methyliminooctan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 58581983 |
| Molecular Formula | C30H47NO2 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.36 |
| IUPAC Name | trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(2R)-7,7-dimethyl-6-methyliminooctan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C([C@H](C)CCC/C(=N/C)C(C)(C)C)=CC[C@@H]23)C[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C30H47NO2/c1-20(10-8-12-28(31-7)29(3,4)5)25-15-16-26-22(11-9-17-30(25,26)6)13-14-23-18-24(32)19-27(33)21(23)2/h13-15,20,24,26-27,32-33H,2,8-12,16-19H2,1,3-7H3/b22-13+,23-14-,31-28-/t20-,24+,26+,27-,30-/m1/s1 |
| InChIKey | ADTUHUNXRKOFKH-FKRMPGOWSA-N |
| XLogP | 6.97 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|