C30H40O4S — CID 91304129
5-[2-[(7aS)-1-[(2R)-5-(benzenesulfonyl)pentan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 91304129) has the molecular formula C30H40O4S and a molecular weight of 496.71 g/mol. Its IUPAC name is 5-[2-[(7aS)-1-[(2R)-5-(benzenesulfonyl)pentan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | 5-[2-[(7aS)-1-[(2R)-5-(benzenesulfonyl)pentan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 91304129 |
| Molecular Formula | C30H40O4S |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 5-[2-[(7aS)-1-[(2R)-5-(benzenesulfonyl)pentan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C([C@H](C)CCCS(=O)(=O)c4ccccc4)=CCC23)CC(O)CC1O |
| InChI | InChI=1S/C30H40O4S/c1-21(9-8-18-35(33,34)26-11-5-4-6-12-26)27-15-16-28-23(10-7-17-30(27,28)3)13-14-24-19-25(31)20-29(32)22(24)2/h4-6,11-15,21,25,28-29,31-32H,2,7-10,16-20H2,1,3H3/t21-,25?,28?,29?,30-/m1/s1 |
| InChIKey | XLKCWFPPMARJQB-XXOZECMUSA-N |
| XLogP | 5.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|