C31H48O4S — CID 91509259
trans-(1R,3S)-5-[2-[(3aS,7aS)-1-[(2R)-4-(1-tert-butylsulfonylcyclobutyl)butan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 91509259) has the molecular formula C31H48O4S and a molecular weight of 516.79 g/mol. Its IUPAC name is trans-(1R,3S)-5-[2-[(3aS,7aS)-1-[(2R)-4-(1-tert-butylsulfonylcyclobutyl)butan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S)-5-[2-[(3aS,7aS)-1-[(2R)-4-(1-tert-butylsulfonylcyclobutyl)butan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 91509259 |
| Molecular Formula | C31H48O4S |
| Molecular Weight | 516.79 g/mol |
| Exact Mass | 516.33 |
| IUPAC Name | trans-(1R,3S)-5-[2-[(3aS,7aS)-1-[(2R)-4-(1-tert-butylsulfonylcyclobutyl)butan-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C([C@H](C)CCC4(S(=O)(=O)C(C)(C)C)CCC4)=CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C31H48O4S/c1-21(14-18-31(16-8-17-31)36(34,35)29(3,4)5)26-12-13-27-23(9-7-15-30(26,27)6)10-11-24-19-25(32)20-28(33)22(24)2/h10-12,21,25,27-28,32-33H,2,7-9,13-20H2,1,3-6H3/t21-,25-,27+,28+,30-/m1/s1 |
| InChIKey | GCMVEKFQOCHPCM-ARPJSNBVSA-N |
| XLogP | 6.60 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.79 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|