C26H32F6O5 — CID 87347083
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate (PubChem CID 87347083) has the molecular formula C26H32F6O5 and a molecular weight of 538.53 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate |
|---|---|
| PubChem CID | 87347083 |
| Molecular Formula | C26H32F6O5 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(1S)-1-[(3aS,7aS)-4-[2-[(3S,5R)-3,5-dihydroxy-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]ethoxy]acetate |
| SMILES | C=C1C(=CC=C2CCC[C@]3(C)C([C@H](C)OCC(=O)OC(C(F)(F)F)C(F)(F)F)=CC[C@@H]23)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C26H32F6O5/c1-14-17(11-18(33)12-21(14)34)7-6-16-5-4-10-24(3)19(8-9-20(16)24)15(2)36-13-22(35)37-23(25(27,28)29)26(30,31)32/h6-8,15,18,20-21,23,33-34H,1,4-5,9-13H2,2-3H3/t15-,18+,20-,21-,24+/m0/s1 |
| InChIKey | HOPKNTYWHGCPHX-VNPYQEQNSA-N |
| XLogP | 5.49 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|