C29H36F6O5 — CID 143025629
[(1R,5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(Z)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate (PubChem CID 143025629) has the molecular formula C29H36F6O5 and a molecular weight of 578.59 g/mol. Its IUPAC name is [(1R,5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(Z)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate.
| Compound Name | [(1R,5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(Z)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate |
|---|---|
| PubChem CID | 143025629 |
| Molecular Formula | C29H36F6O5 |
| Molecular Weight | 578.59 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | [(1R,5R)-3-[(2E)-2-[(7aS)-7a-methyl-1-[(Z)-6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-5-acetyloxycyclohexyl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(=C/C=C2\CCC[C@]3(C)C(CC/C=C\C(O)(C(F)(F)F)C(F)(F)F)=CCC23)C[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C29H36F6O5/c1-18(36)39-23-15-20(16-24(17-23)40-19(2)37)9-10-21-7-6-13-26(3)22(11-12-25(21)26)8-4-5-14-27(38,28(30,31)32)29(33,34)35/h5,9-11,14,23-25,38H,4,6-8,12-13,15-17H2,1-3H3/b14-5-,21-10+/t23-,24-,25?,26-/m1/s1 |
| InChIKey | VMLUZXYGBDNMEU-ZSVKSVKMSA-N |
| XLogP | 7.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.59 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|