C27H37F3O — CID 143095761
(3Z)-3-[(2E)-2-[7a-methyl-1-[(E)-6,6,6-trifluoro-5,5-dimethylhex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol (PubChem CID 143095761) has the molecular formula C27H37F3O and a molecular weight of 434.59 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[7a-methyl-1-[(E)-6,6,6-trifluoro-5,5-dimethylhex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol.
| Compound Name | (3Z)-3-[(2E)-2-[7a-methyl-1-[(E)-6,6,6-trifluoro-5,5-dimethylhex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 143095761 |
| Molecular Formula | C27H37F3O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | (3Z)-3-[(2E)-2-[7a-methyl-1-[(E)-6,6,6-trifluoro-5,5-dimethylhex-3-enyl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-2-methylidenecyclohexan-1-ol |
| SMILES | C=C1/C(=C\C=C2/CCCC3(C)C(CC/C=C/C(C)(C)C(F)(F)F)=CCC23)CCCC1O |
| InChI | InChI=1S/C27H37F3O/c1-19-20(9-7-12-24(19)31)13-14-21-10-8-18-26(4)22(15-16-23(21)26)11-5-6-17-25(2,3)27(28,29)30/h6,13-15,17,23-24,31H,1,5,7-12,16,18H2,2-4H3/b17-6+,20-13-,21-14+ |
| InChIKey | HYLGNVJBIFQPEI-RHZGIIMVSA-N |
| XLogP | 8.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|