C29H45NO3 — CID 89365241
trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(5E)-5-methoxyimino-6,6-dimethylheptyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 89365241) has the molecular formula C29H45NO3 and a molecular weight of 455.68 g/mol. Its IUPAC name is trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(5E)-5-methoxyimino-6,6-dimethylheptyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(5E)-5-methoxyimino-6,6-dimethylheptyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 89365241 |
| Molecular Formula | C29H45NO3 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 455.34 |
| IUPAC Name | trans-(1S,3R,5Z)-5-[(2E)-2-[(3aS,7aS)-1-[(5E)-5-methoxyimino-6,6-dimethylheptyl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C(CCCC/C(=N\OC)C(C)(C)C)=CC[C@@H]23)C[C@H](O)C[C@H]1O |
| InChI | InChI=1S/C29H45NO3/c1-20-22(18-24(31)19-26(20)32)14-13-21-10-9-17-29(5)23(15-16-25(21)29)11-7-8-12-27(30-33-6)28(2,3)4/h13-15,24-26,31-32H,1,7-12,16-19H2,2-6H3/b21-13+,22-14-,30-27+/t24-,25-,26+,29+/m0/s1 |
| InChIKey | KDECZZABEGRFLJ-ANIKDQFESA-N |
| XLogP | 6.66 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|