C29H43FO — CID 143018965
(E,7S)-7-[(4E,7aS)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol (PubChem CID 143018965) has the molecular formula C29H43FO and a molecular weight of 426.66 g/mol. Its IUPAC name is (E,7S)-7-[(4E,7aS)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol.
| Compound Name | (E,7S)-7-[(4E,7aS)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol |
|---|---|
| PubChem CID | 143018965 |
| Molecular Formula | C29H43FO |
| Molecular Weight | 426.66 g/mol |
| Exact Mass | 426.33 |
| IUPAC Name | (E,7S)-7-[(4E,7aS)-4-[(2Z)-2-(3-fluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]-3-ethyloct-4-en-3-ol |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C([C@@H](C)C/C=C/C(O)(CC)CC)=CCC23)CCCC1F |
| InChI | InChI=1S/C29H43FO/c1-6-29(31,7-2)20-9-11-21(3)25-17-18-26-24(13-10-19-28(25,26)5)16-15-23-12-8-14-27(30)22(23)4/h9,15-17,20-21,26-27,31H,4,6-8,10-14,18-19H2,1-3,5H3/b20-9+,23-15-,24-16+/t21-,26?,27?,28+/m0/s1 |
| InChIKey | JRGIQIQCFHFMPD-JILFJNJCSA-N |
| XLogP | 8.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.66 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|