C26H34F2O2 — CID 123537616
methyl 5-[4-[2-(3,5-difluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hex-2-enoate (PubChem CID 123537616) has the molecular formula C26H34F2O2 and a molecular weight of 416.55 g/mol. Its IUPAC name is methyl 5-[4-[2-(3,5-difluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hex-2-enoate.
| Compound Name | methyl 5-[4-[2-(3,5-difluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hex-2-enoate |
|---|---|
| PubChem CID | 123537616 |
| Molecular Formula | C26H34F2O2 |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | methyl 5-[4-[2-(3,5-difluoro-2-methylidenecyclohexylidene)ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]hex-2-enoate |
| SMILES | C=C1C(=CC=C2CCCC3(C)C(C(C)CC=CC(=O)OC)=CCC23)CC(F)CC1F |
| InChI | InChI=1S/C26H34F2O2/c1-17(7-5-9-25(29)30-4)22-12-13-23-19(8-6-14-26(22,23)3)10-11-20-15-21(27)16-24(28)18(20)2/h5,9-12,17,21,23-24H,2,6-8,13-16H2,1,3-4H3 |
| InChIKey | ZVQKPXQXGLEAIG-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|