C30H45FO — CID 143546106
2-[(E,4S)-4-[(4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]pent-1-enyl]-2-ethyloxirane;ethane (PubChem CID 143546106) has the molecular formula C30H45FO and a molecular weight of 440.69 g/mol. Its IUPAC name is 2-[(E,4S)-4-[(4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]pent-1-enyl]-2-ethyloxirane;ethane.
| Compound Name | 2-[(E,4S)-4-[(4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]pent-1-enyl]-2-ethyloxirane;ethane |
|---|---|
| PubChem CID | 143546106 |
| Molecular Formula | C30H45FO |
| Molecular Weight | 440.69 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | 2-[(E,4S)-4-[(4E,7aS)-4-[(2Z)-2-[(3S)-3-fluoro-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-1-yl]pent-1-enyl]-2-ethyloxirane;ethane |
| SMILES | C=C1/C(=C\C=C2/CCC[C@]3(C)C([C@@H](C)C/C=C/C4(CC)CO4)=CCC23)CCC[C@@H]1F.CC |
| InChI | InChI=1S/C28H39FO.C2H6/c1-5-28(19-30-28)18-7-9-20(2)24-15-16-25-23(11-8-17-27(24,25)4)14-13-22-10-6-12-26(29)21(22)3;1-2/h7,13-15,18,20,25-26H,3,5-6,8-12,16-17,19H2,1-2,4H3;1-2H3/b18-7+,22-13-,23-14+;/t20-,25?,26-,27+,28?;/m0./s1 |
| InChIKey | HJKUWEDHQDDWKL-PANMFGQISA-N |
| XLogP | 8.84 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.69 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|