C32H43ClO2S — CID 142907597
(3Z)-3-[(2E)-2-[1-[(Z,2R)-5-(benzenesulfinyl)-5-chloropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol;ethane (PubChem CID 142907597) has the molecular formula C32H43ClO2S and a molecular weight of 527.21 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[1-[(Z,2R)-5-(benzenesulfinyl)-5-chloropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol;ethane.
| Compound Name | (3Z)-3-[(2E)-2-[1-[(Z,2R)-5-(benzenesulfinyl)-5-chloropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol;ethane |
|---|---|
| PubChem CID | 142907597 |
| Molecular Formula | C32H43ClO2S |
| Molecular Weight | 527.21 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | (3Z)-3-[(2E)-2-[1-[(Z,2R)-5-(benzenesulfinyl)-5-chloropent-4-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol;ethane |
| SMILES | C=C1CCC(O)C/C1=C/C=C1\CCCC2(C)C([C@H](C)C/C=C(\Cl)S(=O)c3ccccc3)=CCC12.CC |
| InChI | InChI=1S/C30H37ClO2S.C2H6/c1-21-11-15-25(32)20-24(21)14-13-23-8-7-19-30(3)27(16-17-28(23)30)22(2)12-18-29(31)34(33)26-9-5-4-6-10-26;1-2/h4-6,9-10,13-14,16,18,22,25,28,32H,1,7-8,11-12,15,17,19-20H2,2-3H3;1-2H3/b23-13+,24-14-,29-18+;/t22-,25?,28?,30?,34?;/m1./s1 |
| InChIKey | GAUYJPJQIKMCRO-FFTKVUOKSA-N |
| XLogP | 9.02 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.21 |
| LogP ≤ 5 | 9.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|