C29H43FO3S — CID 53330522
(1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluorohex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 53330522) has the molecular formula C29H43FO3S and a molecular weight of 490.73 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluorohex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluorohex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 53330522 |
| Molecular Formula | C29H43FO3S |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS)-1-[(E,2R)-5-tert-butylsulfonyl-5-fluorohex-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCCC2(C)C([C@H](C)/C=C/C(C)(F)S(=O)(=O)C(C)(C)C)=CC[C@@H]12 |
| InChI | InChI=1S/C29H43FO3S/c1-20-10-13-24(31)19-23(20)12-11-22-9-8-17-28(6)25(14-15-26(22)28)21(2)16-18-29(7,30)34(32,33)27(3,4)5/h11-12,14,16,18,21,24,26,31H,1,8-10,13,15,17,19H2,2-7H3/b18-16+,22-11+,23-12-/t21-,24+,26+,28?,29?/m1/s1 |
| InChIKey | YEDGBQOMZNYGLT-ZQSAUJKQSA-N |
| XLogP | 7.17 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|