C30H48O3S — CID 53330175
(3Z)-3-[(2E)-2-[1-[(E)-5-tert-butylsulfonyl-5-methylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 53330175) has the molecular formula C30H48O3S and a molecular weight of 488.78 g/mol. Its IUPAC name is (3Z)-3-[(2E)-2-[1-[(E)-5-tert-butylsulfonyl-5-methylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (3Z)-3-[(2E)-2-[1-[(E)-5-tert-butylsulfonyl-5-methylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 53330175 |
| Molecular Formula | C30H48O3S |
| Molecular Weight | 488.78 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | (3Z)-3-[(2E)-2-[1-[(E)-5-tert-butylsulfonyl-5-methylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CCC(O)C/C1=C/C=C1\CCCC2(C)C1CCC2C(C)/C=C/C(C)(C)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C30H48O3S/c1-21-11-14-25(31)20-24(21)13-12-23-10-9-18-30(8)26(15-16-27(23)30)22(2)17-19-29(6,7)34(32,33)28(3,4)5/h12-13,17,19,22,25-27,31H,1,9-11,14-16,18,20H2,2-8H3/b19-17+,23-12+,24-13- |
| InChIKey | BHIZGFSRPNFCEY-IAUKEYGLSA-N |
| XLogP | 7.34 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.78 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|