C29H46O3S — CID 53330521
(1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5R)-5-tert-butylsulfonylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 53330521) has the molecular formula C29H46O3S and a molecular weight of 474.75 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5R)-5-tert-butylsulfonylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5R)-5-tert-butylsulfonylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 53330521 |
| Molecular Formula | C29H46O3S |
| Molecular Weight | 474.75 g/mol |
| Exact Mass | 474.32 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aR)-1-[(E,2R,5R)-5-tert-butylsulfonylhex-3-en-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@]2(C)C([C@H](C)/C=C/[C@@H](C)S(=O)(=O)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C29H46O3S/c1-20-11-15-25(30)19-24(20)14-13-23-9-8-18-29(7)26(16-17-27(23)29)21(2)10-12-22(3)33(31,32)28(4,5)6/h10,12-14,21-22,25-27,30H,1,8-9,11,15-19H2,2-7H3/b12-10+,23-13+,24-14-/t21-,22-,25+,26?,27+,29-/m1/s1 |
| InChIKey | QQWDRNIIBNMWCW-DXFGRNJTSA-N |
| XLogP | 6.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.75 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|