C30H44O3S — CID 53330523
(1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-4-(1-tert-butylsulfonylcyclopropyl)but-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 53330523) has the molecular formula C30H44O3S and a molecular weight of 484.75 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-4-(1-tert-butylsulfonylcyclopropyl)but-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-4-(1-tert-butylsulfonylcyclopropyl)but-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 53330523 |
| Molecular Formula | C30H44O3S |
| Molecular Weight | 484.75 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-[(E,2R)-4-(1-tert-butylsulfonylcyclopropyl)but-3-en-2-yl]-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@]2(C)C([C@H](C)/C=C/C3(S(=O)(=O)C(C)(C)C)CC3)=CC[C@@H]12 |
| InChI | InChI=1S/C30H44O3S/c1-21-9-12-25(31)20-24(21)11-10-23-8-7-16-29(6)26(13-14-27(23)29)22(2)15-17-30(18-19-30)34(32,33)28(3,4)5/h10-11,13,15,17,22,25,27,31H,1,7-9,12,14,16,18-20H2,2-6H3/b17-15+,23-10+,24-11-/t22-,25+,27+,29-/m1/s1 |
| InChIKey | WNMOVSJFPJRGQQ-RNQALXTESA-N |
| XLogP | 7.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.75 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|