C25H36F2O3S — CID 134472057
(1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(5,5-difluoro-5-methylsulfonylpentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 134472057) has the molecular formula C25H36F2O3S and a molecular weight of 454.62 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(5,5-difluoro-5-methylsulfonylpentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(5,5-difluoro-5-methylsulfonylpentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 134472057 |
| Molecular Formula | C25H36F2O3S |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-1-(5,5-difluoro-5-methylsulfonylpentan-2-yl)-7a-methyl-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=C1CC[C@H](O)C/C1=C/C=C1\CCC[C@]2(C)C(C(C)CCC(F)(F)S(C)(=O)=O)=CC[C@@H]12 |
| InChI | InChI=1S/C25H36F2O3S/c1-17-7-10-21(28)16-20(17)9-8-19-6-5-14-24(3)22(11-12-23(19)24)18(2)13-15-25(26,27)31(4,29)30/h8-9,11,18,21,23,28H,1,5-7,10,12-16H2,2-4H3/b19-8+,20-9-/t18?,21-,23-,24+/m0/s1 |
| InChIKey | IZOJHFPOXNIFBY-KOXCRBNQSA-N |
| XLogP | 6.13 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|