C32H49NO2 — CID 134477191
(1S,3Z)-3-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R,6Z)-6-prop-2-enoxyiminodecan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol (PubChem CID 134477191) has the molecular formula C32H49NO2 and a molecular weight of 479.75 g/mol. Its IUPAC name is (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R,6Z)-6-prop-2-enoxyiminodecan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol.
| Compound Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R,6Z)-6-prop-2-enoxyiminodecan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 134477191 |
| Molecular Formula | C32H49NO2 |
| Molecular Weight | 479.75 g/mol |
| Exact Mass | 479.38 |
| IUPAC Name | (1S,3Z)-3-[(2E)-2-[(3aS,7aS)-7a-methyl-1-[(2R,6Z)-6-prop-2-enoxyiminodecan-2-yl]-3a,5,6,7-tetrahydro-3H-inden-4-ylidene]ethylidene]-4-methylidenecyclohexan-1-ol |
| SMILES | C=CCO/N=C(/CCCC)CCC[C@@H](C)C1=CC[C@H]2/C(=C/C=C3/C[C@@H](O)CCC3=C)CCC[C@]12C |
| InChI | InChI=1S/C32H49NO2/c1-6-8-13-28(33-35-22-7-2)14-9-11-25(4)30-19-20-31-26(12-10-21-32(30,31)5)16-17-27-23-29(34)18-15-24(27)3/h7,16-17,19,25,29,31,34H,2-3,6,8-15,18,20-23H2,1,4-5H3/b26-16+,27-17-,33-28-/t25-,29+,31+,32-/m1/s1 |
| InChIKey | HEULPZHCQFUZGM-WEMCLYEYSA-N |
| XLogP | 8.63 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.75 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|