C19H24F6O — CID 54513298
6-[(4S,7aS)-4,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol (PubChem CID 54513298) has the molecular formula C19H24F6O and a molecular weight of 382.39 g/mol. Its IUPAC name is 6-[(4S,7aS)-4,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol.
| Compound Name | 6-[(4S,7aS)-4,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol |
|---|---|
| PubChem CID | 54513298 |
| Molecular Formula | C19H24F6O |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 6-[(4S,7aS)-4,7a-dimethyl-3,3a,4,5,6,7-hexahydroinden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)hept-3-yn-2-ol |
| SMILES | CC(CC#CC(O)(C(F)(F)F)C(F)(F)F)C1=CCC2[C@@H](C)CCC[C@]12C |
| InChI | InChI=1S/C19H24F6O/c1-12-6-4-10-16(3)14(12)8-9-15(16)13(2)7-5-11-17(26,18(20,21)22)19(23,24)25/h9,12-14,26H,4,6-8,10H2,1-3H3/t12-,13?,14?,16-/m0/s1 |
| InChIKey | YKQUOXHVZCPLGQ-USPMSXPRSA-N |
| XLogP | 5.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|