C16H28S — CID 59087057
(3aS,7S,7aS)-3a,7-dimethyl-3-[(2R)-4-methylsulfanylbutan-2-yl]-1,4,5,6,7,7a-hexahydroindene (PubChem CID 59087057) has the molecular formula C16H28S and a molecular weight of 252.47 g/mol. Its IUPAC name is (3aS,7S,7aS)-3a,7-dimethyl-3-[(2R)-4-methylsulfanylbutan-2-yl]-1,4,5,6,7,7a-hexahydroindene.
| Compound Name | (3aS,7S,7aS)-3a,7-dimethyl-3-[(2R)-4-methylsulfanylbutan-2-yl]-1,4,5,6,7,7a-hexahydroindene |
|---|---|
| PubChem CID | 59087057 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | (3aS,7S,7aS)-3a,7-dimethyl-3-[(2R)-4-methylsulfanylbutan-2-yl]-1,4,5,6,7,7a-hexahydroindene |
| SMILES | CSCC[C@@H](C)C1=CC[C@H]2[C@@H](C)CCC[C@]12C |
| InChI | InChI=1S/C16H28S/c1-12-6-5-10-16(3)14(12)7-8-15(16)13(2)9-11-17-4/h8,12-14H,5-7,9-11H2,1-4H3/t12-,13+,14-,16-/m0/s1 |
| InChIKey | UAFHIALRDWFVBH-FQLMCAECSA-N |
| XLogP | 5.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|