C15H24O3 — CID 143727779
[(4S,7aS)-1-(1-hydroxypropan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate (PubChem CID 143727779) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is [(4S,7aS)-1-(1-hydroxypropan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate.
| Compound Name | [(4S,7aS)-1-(1-hydroxypropan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate |
|---|---|
| PubChem CID | 143727779 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | [(4S,7aS)-1-(1-hydroxypropan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl] acetate |
| SMILES | CC(=O)O[C@H]1CCC[C@]2(C)C(C(C)CO)=CCC12 |
| InChI | InChI=1S/C15H24O3/c1-10(9-16)12-6-7-13-14(18-11(2)17)5-4-8-15(12,13)3/h6,10,13-14,16H,4-5,7-9H2,1-3H3/t10?,13?,14-,15+/m0/s1 |
| InChIKey | AKRDWFNRBMYCPK-IENUVNBVSA-N |
| XLogP | 2.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|