C21H36O2Si — CID 57137700
6-[(3aS,4R,7aR)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-1-ol (PubChem CID 57137700) has the molecular formula C21H36O2Si and a molecular weight of 348.60 g/mol. Its IUPAC name is 6-[(3aS,4R,7aR)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-1-ol.
| Compound Name | 6-[(3aS,4R,7aR)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-1-ol |
|---|---|
| PubChem CID | 57137700 |
| Molecular Formula | C21H36O2Si |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 6-[(3aS,4R,7aR)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhept-3-yn-1-ol |
| SMILES | CC(C#CCC(C)C1=CC[C@@H]2[C@H](O[Si](C)(C)C)CCC[C@@]12C)CO |
| InChI | InChI=1S/C21H36O2Si/c1-16(15-22)9-7-10-17(2)18-12-13-19-20(23-24(4,5)6)11-8-14-21(18,19)3/h12,16-17,19-20,22H,8,10-11,13-15H2,1-6H3/t16?,17?,19-,20-,21+/m1/s1 |
| InChIKey | LKANVSYFOWDVKR-QCRWKMLFSA-N |
| XLogP | 5.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|