C23H40OSi — CID 100995927
[(3aR,4S,7aS)-1-[(2R)-dec-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane (PubChem CID 100995927) has the molecular formula C23H40OSi and a molecular weight of 360.66 g/mol. Its IUPAC name is [(3aR,4S,7aS)-1-[(2R)-dec-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane.
| Compound Name | [(3aR,4S,7aS)-1-[(2R)-dec-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 100995927 |
| Molecular Formula | C23H40OSi |
| Molecular Weight | 360.66 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | [(3aR,4S,7aS)-1-[(2R)-dec-4-yn-2-yl]-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane |
| SMILES | CCCCCC#CC[C@@H](C)C1=CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C23H40OSi/c1-7-8-9-10-11-12-14-19(2)20-16-17-21-22(24-25(4,5)6)15-13-18-23(20,21)3/h16,19,21-22H,7-10,13-15,17-18H2,1-6H3/t19-,21+,22+,23-/m1/s1 |
| InChIKey | VJNGYSAYSLIVEP-YPIGPJMWSA-N |
| XLogP | 6.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.66 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|