C26H48O2Si2 — CID 100993427
[6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhex-3-yn-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 100993427) has the molecular formula C26H48O2Si2 and a molecular weight of 448.84 g/mol. Its IUPAC name is [6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhex-3-yn-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhex-3-yn-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 100993427 |
| Molecular Formula | C26H48O2Si2 |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.32 |
| IUPAC Name | [6-[(3aR,4S,7aS)-7a-methyl-4-trimethylsilyloxy-3,3a,4,5,6,7-hexahydroinden-1-yl]-2-methylhex-3-yn-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C#CCCC1=CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H48O2Si2/c1-24(2,3)30(10,11)28-25(4,5)19-13-12-15-21-17-18-22-23(27-29(7,8)9)16-14-20-26(21,22)6/h17,22-23H,12,14-16,18,20H2,1-11H3/t22-,23-,26+/m0/s1 |
| InChIKey | XQJDYCDSDHDRSS-JCYRPKCISA-N |
| XLogP | 7.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|