C24H42O2Si — CID 11625297
7-[(3aR,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1,2,3,6,7,7a-hexahydroinden-4-yl]-2-methylhept-6-yn-2-ol (PubChem CID 11625297) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is 7-[(3aR,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1,2,3,6,7,7a-hexahydroinden-4-yl]-2-methylhept-6-yn-2-ol.
| Compound Name | 7-[(3aR,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1,2,3,6,7,7a-hexahydroinden-4-yl]-2-methylhept-6-yn-2-ol |
|---|---|
| PubChem CID | 11625297 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | 7-[(3aR,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-3a-methyl-1,2,3,6,7,7a-hexahydroinden-4-yl]-2-methylhept-6-yn-2-ol |
| SMILES | CC(C)(O)CCCC#CC1=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2CCC[C@@]12C |
| InChI | InChI=1S/C24H42O2Si/c1-22(2,3)27(7,8)26-21-16-15-19(24(6)18-12-14-20(21)24)13-10-9-11-17-23(4,5)25/h15,20-21,25H,9,11-12,14,16-18H2,1-8H3/t20-,21-,24-/m0/s1 |
| InChIKey | HILBTPYBVQXBKN-HFMPRLQTSA-N |
| XLogP | 6.46 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|