C30H58O2Si2 — CID 99772226
tert-butyl-[[(1R,3R,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl]oxy]-dimethylsilane (PubChem CID 99772226) has the molecular formula C30H58O2Si2 and a molecular weight of 506.96 g/mol. Its IUPAC name is tert-butyl-[[(1R,3R,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3R,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 99772226 |
| Molecular Formula | C30H58O2Si2 |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | tert-butyl-[[(1R,3R,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl]oxy]-dimethylsilane |
| SMILES | CC1(C)/C2=C/C[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]3(C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1CC2 |
| InChI | InChI=1S/C30H58O2Si2/c1-27(2,3)33(10,11)31-25-15-14-20-30(9)24(25)19-18-22-16-17-23(29(22,7)8)21-26(30)32-34(12,13)28(4,5)6/h18,23-26H,14-17,19-21H2,1-13H3/b22-18+/t23-,24+,25+,26-,30-/m1/s1 |
| InChIKey | ZKKCZVGGGVUXBT-QXDSHTBMSA-N |
| XLogP | 9.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|