C26H45ClO3Si — CID 99772040
[(1R,3S,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl] 2-chloroacetate (PubChem CID 99772040) has the molecular formula C26H45ClO3Si and a molecular weight of 469.18 g/mol. Its IUPAC name is [(1R,3S,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl] 2-chloroacetate.
| Compound Name | [(1R,3S,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl] 2-chloroacetate |
|---|---|
| PubChem CID | 99772040 |
| Molecular Formula | C26H45ClO3Si |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | [(1R,3S,4R,8S,9R,11E)-8-[tert-butyl(dimethyl)silyl]oxy-4,15,15-trimethyl-3-tricyclo[10.2.1.04,9]pentadec-11-enyl] 2-chloroacetate |
| SMILES | CC1(C)/C2=C/C[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]3(C)[C@@H](OC(=O)CCl)C[C@H]1CC2 |
| InChI | InChI=1S/C26H45ClO3Si/c1-24(2,3)31(7,8)30-21-10-9-15-26(6)20(21)14-13-18-11-12-19(25(18,4)5)16-22(26)29-23(28)17-27/h13,19-22H,9-12,14-17H2,1-8H3/b18-13+/t19-,20+,21+,22+,26-/m1/s1 |
| InChIKey | DWJZWKHFYVIJBX-DMPVVJLLSA-N |
| XLogP | 7.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|