C24H46O4Si — CID 99772101
(1S,2R,4R,5R,9R,10S,12S)-5-[tert-butyl(dimethyl)silyl]oxy-9,15,15-trimethyltricyclo[10.2.1.04,9]pentadecane-1,2,10-triol (PubChem CID 99772101) has the molecular formula C24H46O4Si and a molecular weight of 426.71 g/mol. Its IUPAC name is (1S,2R,4R,5R,9R,10S,12S)-5-[tert-butyl(dimethyl)silyl]oxy-9,15,15-trimethyltricyclo[10.2.1.04,9]pentadecane-1,2,10-triol.
| Compound Name | (1S,2R,4R,5R,9R,10S,12S)-5-[tert-butyl(dimethyl)silyl]oxy-9,15,15-trimethyltricyclo[10.2.1.04,9]pentadecane-1,2,10-triol |
|---|---|
| PubChem CID | 99772101 |
| Molecular Formula | C24H46O4Si |
| Molecular Weight | 426.71 g/mol |
| Exact Mass | 426.32 |
| IUPAC Name | (1S,2R,4R,5R,9R,10S,12S)-5-[tert-butyl(dimethyl)silyl]oxy-9,15,15-trimethyltricyclo[10.2.1.04,9]pentadecane-1,2,10-triol |
| SMILES | CC1(C)[C@H]2CC[C@@]1(O)[C@H](O)C[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]1(C)[C@@H](O)C2 |
| InChI | InChI=1S/C24H46O4Si/c1-21(2,3)29(7,8)28-18-10-9-12-23(6)17(18)15-20(26)24(27)13-11-16(14-19(23)25)22(24,4)5/h16-20,25-27H,9-15H2,1-8H3/t16-,17-,18+,19-,20+,23+,24+/m0/s1 |
| InChIKey | CCKINLAWKCWDHU-GFVCYSRNSA-N |
| XLogP | 4.87 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.71 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|