C26H45ClO3Si — CID 125036395
(1S,2S,4R,6R,7S,11R,12S,14S)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-12-hydroxy-11,17,17-trimethyltetracyclo[12.2.1.01,4.06,11]heptadecan-3-one (PubChem CID 125036395) has the molecular formula C26H45ClO3Si and a molecular weight of 469.18 g/mol. Its IUPAC name is (1S,2S,4R,6R,7S,11R,12S,14S)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-12-hydroxy-11,17,17-trimethyltetracyclo[12.2.1.01,4.06,11]heptadecan-3-one.
| Compound Name | (1S,2S,4R,6R,7S,11R,12S,14S)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-12-hydroxy-11,17,17-trimethyltetracyclo[12.2.1.01,4.06,11]heptadecan-3-one |
|---|---|
| PubChem CID | 125036395 |
| Molecular Formula | C26H45ClO3Si |
| Molecular Weight | 469.18 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | (1S,2S,4R,6R,7S,11R,12S,14S)-7-[tert-butyl(dimethyl)silyl]oxy-2-chloro-12-hydroxy-11,17,17-trimethyltetracyclo[12.2.1.01,4.06,11]heptadecan-3-one |
| SMILES | CC1(C)[C@H]2CC[C@@]13[C@H](Cl)C(=O)[C@@H]3C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@@]1(C)[C@@H](O)C2 |
| InChI | InChI=1S/C26H45ClO3Si/c1-23(2,3)31(7,8)30-19-10-9-12-25(6)17(19)15-18-21(29)22(27)26(18)13-11-16(14-20(25)28)24(26,4)5/h16-20,22,28H,9-15H2,1-8H3/t16-,17-,18-,19-,20-,22+,25+,26+/m0/s1 |
| InChIKey | WCMMBNGYLSPLMX-OUTGOGLXSA-N |
| XLogP | 6.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.18 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|