C26H40F6O2 — CID 143647405
(1R,7aR)-7a-methyl-1-[(6R)-1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)undec-3-yn-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane (PubChem CID 143647405) has the molecular formula C26H40F6O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is (1R,7aR)-7a-methyl-1-[(6R)-1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)undec-3-yn-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane.
| Compound Name | (1R,7aR)-7a-methyl-1-[(6R)-1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)undec-3-yn-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
|---|---|
| PubChem CID | 143647405 |
| Molecular Formula | C26H40F6O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.29 |
| IUPAC Name | (1R,7aR)-7a-methyl-1-[(6R)-1,1,1-trifluoro-2-hydroxy-6,10-dimethyl-2-(trifluoromethyl)undec-3-yn-6-yl]-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
| SMILES | CC.CC(C)CCC[C@](C)(CC#CC(O)(C(F)(F)F)C(F)(F)F)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C24H34F6O2.C2H6/c1-16(2)8-5-12-20(3,13-7-15-22(32,23(25,26)27)24(28,29)30)19-11-10-17-18(31)9-6-14-21(17,19)4;1-2/h16-17,19,32H,5-6,8-14H2,1-4H3;1-2H3/t17?,19-,20-,21+;/m1./s1 |
| InChIKey | DVPYCGGXIANCKN-ZSYUMHBFSA-N |
| XLogP | 7.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|