C24H42O — CID 143647417
(1R,7aR)-1-[(5S)-5,9-dimethyldec-2-yn-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane (PubChem CID 143647417) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is (1R,7aR)-1-[(5S)-5,9-dimethyldec-2-yn-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane.
| Compound Name | (1R,7aR)-1-[(5S)-5,9-dimethyldec-2-yn-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
|---|---|
| PubChem CID | 143647417 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | (1R,7aR)-1-[(5S)-5,9-dimethyldec-2-yn-5-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-one;ethane |
| SMILES | CC.CC#CC[C@](C)(CCCC(C)C)[C@H]1CCC2C(=O)CCC[C@@]21C |
| InChI | InChI=1S/C22H36O.C2H6/c1-6-7-14-21(4,15-8-10-17(2)3)20-13-12-18-19(23)11-9-16-22(18,20)5;1-2/h17-18,20H,8-16H2,1-5H3;1-2H3/t18?,20-,21-,22+;/m1./s1 |
| InChIKey | MYBGABZCYSMGIN-IBQMQHRLSA-N |
| XLogP | 7.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|