C20H30O2 — CID 70303548
(1R,3aR,4S,7aR)-1-[4-(3-hydroxyphenyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 70303548) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1R,3aR,4S,7aR)-1-[4-(3-hydroxyphenyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aR)-1-[4-(3-hydroxyphenyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 70303548 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1R,3aR,4S,7aR)-1-[4-(3-hydroxyphenyl)butan-2-yl]-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(CCc1cccc(O)c1)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12C |
| InChI | InChI=1S/C20H30O2/c1-14(8-9-15-5-3-6-16(21)13-15)17-10-11-18-19(22)7-4-12-20(17,18)2/h3,5-6,13-14,17-19,21-22H,4,7-12H2,1-2H3/t14?,17-,18+,19+,20-/m1/s1 |
| InChIKey | ZLOJDZJXXXLYEY-PSTOSHBPSA-N |
| XLogP | 4.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |