C21H38O3 — CID 22983275
7a-methyl-1-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 22983275) has the molecular formula C21H38O3 and a molecular weight of 338.53 g/mol. Its IUPAC name is 7a-methyl-1-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | 7a-methyl-1-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 22983275 |
| Molecular Formula | C21H38O3 |
| Molecular Weight | 338.53 g/mol |
| Exact Mass | 338.28 |
| IUPAC Name | 7a-methyl-1-[4-(2,2,5,5-tetramethyl-1,3-dioxolan-4-yl)butan-2-yl]-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(CCC1OC(C)(C)OC1(C)C)C1CCC2C(O)CCCC12C |
| InChI | InChI=1S/C21H38O3/c1-14(9-12-18-19(2,3)24-20(4,5)23-18)15-10-11-16-17(22)8-7-13-21(15,16)6/h14-18,22H,7-13H2,1-6H3 |
| InChIKey | PVHQLPWVLYDRNO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |