C19H35O2P — CID 59977742
(1R,7aS)-7a-ethenyl-1-(6-methyl-6-phosphanyloxyheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 59977742) has the molecular formula C19H35O2P and a molecular weight of 326.46 g/mol. Its IUPAC name is (1R,7aS)-7a-ethenyl-1-(6-methyl-6-phosphanyloxyheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,7aS)-7a-ethenyl-1-(6-methyl-6-phosphanyloxyheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 59977742 |
| Molecular Formula | C19H35O2P |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (1R,7aS)-7a-ethenyl-1-(6-methyl-6-phosphanyloxyheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | C=C[C@]12CCCC(O)C1CC[C@@H]2C(C)CCCC(C)(C)OP |
| InChI | InChI=1S/C19H35O2P/c1-5-19-13-7-9-17(20)16(19)11-10-15(19)14(2)8-6-12-18(3,4)21-22/h5,14-17,20H,1,6-13,22H2,2-4H3/t14?,15-,16?,17?,19-/m1/s1 |
| InChIKey | HXOBEPXDFZNIAD-YZPQZGRSSA-N |
| XLogP | 5.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|