C13H23NO2 — CID 58904442
(1R,3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 58904442) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (1R,3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 58904442 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (1R,3aR,4S,7aS)-7a-[(E)-hydroxyiminomethyl]-1-propan-2-yl-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(C)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12/C=N/O |
| InChI | InChI=1S/C13H23NO2/c1-9(2)10-5-6-11-12(15)4-3-7-13(10,11)8-14-16/h8-12,15-16H,3-7H2,1-2H3/b14-8+/t10-,11+,12+,13+/m1/s1 |
| InChIKey | GJZXDHOEIOIIHP-PQBBFMNFSA-N |
| XLogP | 2.66 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|