C18H33NO2 — CID 91485050
(1R,3aR,4S,7aS)-1-[(2S)-6-methylheptan-2-yl]-7a-(nitrosomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol (PubChem CID 91485050) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is (1R,3aR,4S,7aS)-1-[(2S)-6-methylheptan-2-yl]-7a-(nitrosomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol.
| Compound Name | (1R,3aR,4S,7aS)-1-[(2S)-6-methylheptan-2-yl]-7a-(nitrosomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
|---|---|
| PubChem CID | 91485050 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | (1R,3aR,4S,7aS)-1-[(2S)-6-methylheptan-2-yl]-7a-(nitrosomethyl)-1,2,3,3a,4,5,6,7-octahydroinden-4-ol |
| SMILES | CC(C)CCC[C@H](C)[C@H]1CC[C@H]2[C@@H](O)CCC[C@]12CN=O |
| InChI | InChI=1S/C18H33NO2/c1-13(2)6-4-7-14(3)15-9-10-16-17(20)8-5-11-18(15,16)12-19-21/h13-17,20H,4-12H2,1-3H3/t14-,15+,16-,17-,18-/m0/s1 |
| InChIKey | CIEPSRVWEYMZLF-ADHGMGHFSA-N |
| XLogP | 4.77 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |