C19H34O — CID 174274223
7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde (PubChem CID 174274223) has the molecular formula C19H34O and a molecular weight of 278.48 g/mol. Its IUPAC name is 7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde.
| Compound Name | 7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde |
|---|---|
| PubChem CID | 174274223 |
| Molecular Formula | C19H34O |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | 7a-methyl-1-(6-methylheptan-2-yl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde |
| SMILES | CC(C)CCCC(C)C1CCC2C(C=O)CCCC12C |
| InChI | InChI=1S/C19H34O/c1-14(2)7-5-8-15(3)17-10-11-18-16(13-20)9-6-12-19(17,18)4/h13-18H,5-12H2,1-4H3 |
| InChIKey | QIWRYVWUTIINJO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|