C28H48O2 — CID 158187295
(1R,3aS,4S,5S,7aR)-5-[(1R,2S,4S)-2-formyl-1,4-dimethylcyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde (PubChem CID 158187295) has the molecular formula C28H48O2 and a molecular weight of 416.69 g/mol. Its IUPAC name is (1R,3aS,4S,5S,7aR)-5-[(1R,2S,4S)-2-formyl-1,4-dimethylcyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde.
| Compound Name | (1R,3aS,4S,5S,7aR)-5-[(1R,2S,4S)-2-formyl-1,4-dimethylcyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde |
|---|---|
| PubChem CID | 158187295 |
| Molecular Formula | C28H48O2 |
| Molecular Weight | 416.69 g/mol |
| Exact Mass | 416.37 |
| IUPAC Name | (1R,3aS,4S,5S,7aR)-5-[(1R,2S,4S)-2-formyl-1,4-dimethylcyclohexyl]-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carbaldehyde |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H](C=O)[C@@H]([C@@]3(C)CC[C@H](C)C[C@@H]3C=O)CC[C@]12C |
| InChI | InChI=1S/C28H48O2/c1-19(2)8-7-9-21(4)24-10-11-25-23(18-30)26(13-15-28(24,25)6)27(5)14-12-20(3)16-22(27)17-29/h17-26H,7-16H2,1-6H3/t20-,21+,22+,23-,24+,25-,26-,27-,28+/m0/s1 |
| InChIKey | DNPZXCPXXYWNHG-WTPIMUJOSA-N |
| XLogP | 7.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.69 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|