C27H47NO3 — CID 14776866
(1S,2R,4S,5R,7S,11S,12S,15R,16R)-4,5-dihydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-azatetracyclo[9.7.0.02,7.012,16]octadecan-9-one (PubChem CID 14776866) has the molecular formula C27H47NO3 and a molecular weight of 433.68 g/mol. Its IUPAC name is (1S,2R,4S,5R,7S,11S,12S,15R,16R)-4,5-dihydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-azatetracyclo[9.7.0.02,7.012,16]octadecan-9-one.
| Compound Name | (1S,2R,4S,5R,7S,11S,12S,15R,16R)-4,5-dihydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-azatetracyclo[9.7.0.02,7.012,16]octadecan-9-one |
|---|---|
| PubChem CID | 14776866 |
| Molecular Formula | C27H47NO3 |
| Molecular Weight | 433.68 g/mol |
| Exact Mass | 433.36 |
| IUPAC Name | (1S,2R,4S,5R,7S,11S,12S,15R,16R)-4,5-dihydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-8-azatetracyclo[9.7.0.02,7.012,16]octadecan-9-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(=O)N[C@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H47NO3/c1-16(2)7-6-8-17(3)19-9-10-20-18-13-25(31)28-24-14-22(29)23(30)15-27(24,5)21(18)11-12-26(19,20)4/h16-24,29-30H,6-15H2,1-5H3,(H,28,31)/t17-,18+,19-,20+,21+,22-,23+,24+,26-,27-/m1/s1 |
| InChIKey | WHDHFUYJROTAAS-YJJKLKRJSA-N |
| XLogP | 4.92 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.68 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |